Zu "886-86-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ethyl 3-Aminobenzoate (methanesulfonate)
Artikelnummer: Cay20660-10
Ethyl 3-aminobenzoate (methanesulfonate), a hydrophilic derivative of benzocaine (Cay-20132), is an anesthetic used by hatcheries and in research studies to immobilize fish for marking, transport, or to suppress sensory systems during invasive procedures such as the implantation of electronic tags.Formal Name:...
| Schlagworte: | Ethyl m-Aminobenzoate, MS-222, NSC 93790, 3-amino-benzoic acid-ethyl ester, monomethanesulfonate |
| Anwendung: | Anesthetic |
| CAS | 886-86-2 |
| MW: | 261.3 D |
ab 60,00 €
Tricaine methanesulfonate
Artikelnummer: TGM-T21483-5g
Description: Tricaine methanesulfonate (MS-222) (TMS) is an anesthetic. Many hatcheries and research studies use TMS to immobilize fish for marking or transport and to suppress sensory systems during invasive procedures. Target: Others. Smiles: CCOC(c1cc(N)ccc1)=O.CS(O)(=O)=O
| Schlagworte: | MS-222 |
| Anwendung: | Anesthetic (local) |
| CAS | 886-86-2 |
| MW: | 261.3 D |
51,00 €
