Zu "882697-00-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anle138b
Artikelnummer: Cay34259-5
Anle138b is an inhibitor of protein aggregation. It inhibits alpha-synuclein oligomer formation and PrPSc prion propagation by 77 and 84%, respectively, when used at a concentration of 10 µM. Anle138b (1 mg/animal) inhibits brain accumulation of PrPSc in, and increases survival of, prion-infected mice. It reduces...
| Schlagworte: | 3-(1,3-benzodioxol-5-yl)-5-(3-bromophenyl)-1H-pyrazole |
| Anwendung: | Protein aggregation inhibitor |
| CAS | 882697-00-9 |
| MW: | 343.2 D |
ab 49,00 €
Anle138b
Artikelnummer: TGM-T5447-100mg
Description: Anle138b: a novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease. Target: Beta Amyloid. Smiles: Brc1cccc(c1)-c1cc(n[nH]1)-c1ccc2OCOc2c1. References: Wagner J, et al. Anle138b: a novel oligomer modulator for disease-modifying therapy...
| Anwendung: | Protein aggregation inhibitor |
| CAS | 882697-00-9 |
| MW: | 343.17 D |
ab 38,00 €
