Zu "880635-03-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GW 6471
Artikelnummer: Cay11697-1
The peroxisome proliferator-activated receptor alpha (PPARalpha) is a nuclear receptor that regulates the expression of genes involved in fatty acid metabolism, lipoprotein synthesis and metabolism, and inflammation. GW 6471 is an antagonist of PPARalpha (IC50 = 240 nM). It drives the displacement of coactivators...
| Schlagworte: | N-[(2S)-2-[[(1Z)-1-methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propen-1-yl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)e... |
| Anwendung: | PPARalpha antagonist |
| CAS | 880635-03-0 |
| MW: | 619.7 D |
ab 69,00 €
GW6471
Artikelnummer: TGM-T8486-100mg
Description: GW6471 is an antagonist of PPARalpha with IC50 of 0.24 µ M. GW6471 enhances the binding affinity of the PPAR alpha ligand-binding domain to the co-repressor proteins SMRT and NCoR. Target: PPAR. Smiles: CCC(=O)NC[C@H](Cc1ccc(OCCc2nc(oc2C)-c2ccccc2)cc1)N\C(C)=C/C(=O)c1ccc(cc1)C(F)(F)F. References: Abu...
| Schlagworte: | GW 6471 |
| Anwendung: | PPARalpha antagonist |
| CAS | 880635-03-0 |
| MW: | 619.67 D |
ab 31,00 €
