Zu "875685-46-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
10-Nitrooleate
Artikelnummer: Cay10008043-1
Nitrated unsaturated fatty acids, such as 10- and 12-nitrolinoleate (LNO2, Cay-10037), cholesteryl nitrolinoleate, and nitrohydroxylinoleate, represent a new class of endogenous lipid-derived signalling molecules. LNO2 isomers serve as potent endogenous ligands for PPARgamma and can also decompose or be metabolized...
| Schlagworte: | 10-nitro-9-trans-Octadecenoic Acid, 10-Nitrooleic Acid, 10-nitro-9E-octadecenoic acid |
| Anwendung: | Bioactive lipid assays |
| CAS | 875685-46-4 |
| MW: | 327.5 D |
ab 126,00 €
10-Nitrooleic acid
Artikelnummer: TGM-T27103-1mg
Description: CXA-10 is an endogenous nitro-fatty acid (NFA) modulator of Nrf2 and NF-kappaB. CXA-10 upregulates expression of caveolin-1, the major structural component of caveolae. Target: Others. Smiles: C(=C\CCCCCCCC(O)=O)(\CCCCCCCC)/N(=O)=O. References: Zheng R, Heck DE, Black AT, Gow A, Laskin DL, Laskin JD....
| Schlagworte: | CXA10, 10 Nitrooleic acid, CXA-10, CXA 10 |
| CAS | 875685-46-4 |
| MW: | 327.46 D |
ab 106,00 €
