Zu "872679-70-4" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Fmoc-NH-PEG2-CH2CH2COOH
Fmoc-NH-PEG2-CH2CH2COOH

Artikelnummer: TGM-T15315-100mg

Description: Fmoc-NH-PEG2-CH2CH2COOH is a cleavable ADC linker utilized in the synthesis of antibody-drug conjugates (ADCs)[1]. Target: Others, ADC Linker. Smiles: OC(=O)CCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12. References: Fulcher JM, et al. Chemical synthesis of Shiga toxin subunit B using a next-generation traceless...
CAS 872679-70-4
MW: 399.44 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten
Fmoc-9-amino-4,7- dioxanonanoic acid
Fmoc-9-amino-4,7- dioxanonanoic acid

Artikelnummer: CSB-DT2648.1

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
Anwendung: Peptide synthesis
CAS 872679-70-4
MW: 399.443 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten