Zu "868049-49-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Olodaterol
Artikelnummer: TGM-T3457-1mg
Description: Olodaterol is a novel, long-acting beta2-adrenergic agonist (LABA) that exerts its pharmacological effect by binding and activating beta2-adrenergic receptors located primarily in the lungs. Target: Adrenergic Receptor. Smiles: COc1ccc(CC(C)(C)NC[C@H](O)c2cc(O)cc3NC(=O)COc23)cc1. References: Bouyssou T,...
| Schlagworte: | Striverdi Respimat, BI1744 |
| Anwendung: | Targets adrenergic receptor beta-2 (ADRB2) |
| CAS | 868049-49-4 |
| MW: | 386.45 D |
ab 42,00 €
Olodaterol
Artikelnummer: Cay21794-1
Olodaterol is a selective agonist of beta2-adrenergic receptors (beta2-ARs, EC50s = 97.7 and 2,725 nM for human beta2- and beta1-ARs, respectively). In vivo, olodaterol completely reverses acetylcholine-induced bronchoconstriction without cardiovascular side effects in guinea pigs. It also exhibits dose-dependent...
| Schlagworte: | BI-1744, 6-hydroxy-8-[(1R)-1-hydroxy-2-[[2-(4-methoxyphenyl)-1,1-dimethylethyl]amino]ethyl]-2H-1,4-benzoxazin-3(4H)-one |
| Anwendung: | beta2-Adrenergic receptor agonist |
| CAS | 868049-49-4 |
| MW: | 386.4 D |
ab 121,00 €
