Zu "865783-99-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Briciclib
Artikelnummer: TGM-T3207-100mg
Description: Briciclib (ON 014185) is a small molecule that inhibits cyclin D1 accumulation in Y cells. Target: PERK, Autophagy, CDK. Smiles: C(=C/S(CC1=CC(OP(=O)(O)O)=C(OC)C=C1)(=O)=O)\C2=C(OC)C=C(OC)C=C2OC. References: Neel Jasani, et al. DOI: 10.1158/1538-7445.
| Schlagworte: | ON 014185 |
| Anwendung: | Targets translation initiation factor 4E (EIF4E) |
| CAS | 865783-99-9 |
| MW: | 474.42 D |
ab 40,00 €
Briciclib
Artikelnummer: Cay22989-1
Briciclib is a water soluble derivative of ON 013100, a small molecule that binds to and inhibits eukaryotic translation initiation factor 4E (eIF4E). Briciclib inhibits proliferation of JEKO-1 and Mino mantle cell leukemia (MCL), MCF-7 and MDA-MB-231 breast, AGS gastric, and OE19, OE33, and LFO-1 esophageal cancer...
| Schlagworte: | ON-014185, 2-methoxy-5-[[[(1E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl]methyl]-phenol 1-(dihydrogen phosphate) |
| Anwendung: | eIF4E binding, cap-dependent translation inhibitor |
| CAS | 865783-99-9 |
| MW: | 474.4 D |
ab 52,00 €
