Zu "865466-24-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Narlaprevir
Artikelnummer: Cay42487-1
An HCV NS3 inhibitor (Ki = 6 nM), also inhibits SARS-CoV-2 Mpro (IC50 = 16.11 µM), inhibits HCV replication in a cell-based replicon assay (EC90 = 40 nM) and SARS-CoV-2 replication in Vero cells (EC50 = 7.43 µM). Formulation: A solid. InChI:...
| Schlagworte: | SCH 900518,... |
| Anwendung: | HCV NS3 inhibitor |
| CAS | 865466-24-6 |
| MW: | 707.97 D |
ab 137,00 €
Narlaprevir
Artikelnummer: TGM-T16274-2mg
Description: Narlaprevir is an effective, selective, and orally bioavailable NS3 protease inhibitor(Ki=6 nM, EC90=40 nM). Target: Others. Smiles: [H][C@]12CN([C@H](C(=O)N[C@@H](CCCC)C(=O)C(=O)NC3CC3)[C@@]1([H])C2(C)C)C(=O)[C@@H](NC(=O)NC1(CS(=O)(=O)C(C)(C)C)CCCCC1)C(C)(C)C. References: Ashok Arasappan, et al....
| Schlagworte: | SCH 900518 |
| Anwendung: | Antiviral, Protease inhibitor |
| CAS | 865466-24-6 |
| MW: | 707.96 D |
235,00 €
