Zu "864082-23-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK270822A
Artikelnummer: Cay43717-1
GSK270822A is an inhibitor of G protein-coupled receptor kinase 2 (GRK2, IC50 = 12. µM). It is selective for GRK2 over GRK1, GRK5, and PKA (IC50s = 794, 63. and 50. µM, respectively). InChI:...
| Schlagworte: | 1,4,5,6-tetrahydro-N-1H-indazol-5-yl-2-methyl-4-(2-naphthalenyl)-6-oxo-3-pyridinecarboxamide |
| Anwendung: | GRK2 inhibitor |
| CAS | 864082-23-5 |
| MW: | 396.45 D |
ab 153,00 €
GSK270822A
Artikelnummer: TGM-T27467-100mg
Description: GSK270822A is a selective ROCK1 inhibitor. GSK270822A exhibits IC50 of 9nM, 1100nM, 1550nM for ROCK1, RSK1, p70S6K, respectively. Target: GRK, ROCK. Smiles: C(NC=1C=C2C(=CC1)NN=C2)(=O)C=3C(CC(=O)NC3C)C4=CC5=C(C=C4)C=CC=C5
| Schlagworte: | GSK 270822A , GSK-270822A |
| CAS | 864082-23-5 |
| MW: | 396.44 D |
ab 134,00 €
