Zu "863918-78-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Methoxy-X04
Artikelnummer: Cay20476-10
Methoxy-X04 is a brain-permeable fluorescent probe for amyloid-beta (Abeta) to detect and quantify plaques, tangles, and cerebrovascular amyloid. It displays high in vitro binding affinity (Ki = 26.8 nM) for fibrillar beta-sheet deposits and is used to image Abeta plaques in the brains of living APP/PS1 mice, a...
| Schlagworte: | 4,4'-[(2-methoxy-1,4-phenylene)di-(1E)-2,1-ethenediyl]bis-phenol |
| Anwendung: | Fluorescent amyloid self-assembly probe |
| CAS | 863918-78-9 |
| MW: | 344.4 D |
ab 44,00 €
Methoxy-X04
Artikelnummer: TGM-T22972-100mg
Description: Methoxy-X04, a derivative of Congo red and Chrysamine-G, is a brain-permeable fluorescent probe for amyloid-beta (Abeta). Target: Others. Smiles: COc1cc(\C=C\c2ccc(O)cc2)ccc1\C=C\c1ccc(O)cc1
| CAS | 863918-78-9 |
| MW: | 344.4 D |
ab 34,00 €
