Zu "85375-15-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
SKF 89976A (hydrochloride)
Artikelnummer: Cay42449-10
SKF 89976A is an inhibitor of GABA transporter 1 (GAT1, IC50s = 0. and 0. µM for the human and rat transporters, respectively). It is selective for GAT1 over rat GAT2, human GAT3, and human betaine/GABA transporter 3 (BGT3, IC50s = 550, 944, and 7,210 µM, respectively). SKF 89976A inhibits GABA uptake in rat...
| Schlagworte: | 1-(4,4-diphenyl-3-buten-1-yl)-3-piperidinecarboxylic acid, monohydrochloride |
| Anwendung: | GAT1 (GABA transporter 1) inhibitor |
| CAS | 85375-15-1 |
| MW: | 371.9 D |
ab 55,00 €
SKF89976A hydrochloride
Artikelnummer: TGM-T12930-100mg
Description: SKF89976A hydrochloride (d,l-SKF89976A hydrochloride) is a selective inhibitor GABA transporter such as GAT-1 (IC50s = 0.28 µM), GAT-2 (IC50s = 137.34 µM) and GAT-3(IC50s = 202.8 µM) in CHO cells. Target: GABA Receptor. Smiles: Cl.OC(=O)C1CCCN(CCC=C(c2ccccc2)c2ccccc2)C1. References: Jinzenji A, et al....
| Schlagworte: | d,l-SKF89976A hydrochloride |
| CAS | 85375-15-1 |
| MW: | 371.9 D |
ab 62,00 €
