Zu "851723-84-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Timapiprant
Artikelnummer: TGM-T2664-100mg
Description: Timapiprant (OC000459) is a potent and selective D prostanoid receptor 2 (DP2) antagonist (IC50: 13 nM). Target: Prostaglandin Receptor, GPR. Smiles: Cc1c(Cc2ccc3ccccc3n2)c2cc(F)ccc2n1CC(O)=O. References: Pettipher R, et al. J Pharmacol Exp Ther, 2012, 340(2), 473-482.
| Schlagworte: | OC000459 |
| CAS | 851723-84-7 |
| MW: | 348.37 D |
ab 31,00 €
OC000459
Artikelnummer: Cay12027-25
OC000459 is a potent, selective DP2 antagonist that displaces [3H]prostaglandin D2 ([3H]PGD2) from human recombinant DP2 receptors (Ki = 13 nM), rat recombinant DP2 receptors (Ki = 3 nM), and human native DP2 (Ki = 4 nM, Th2 cell membranes) without interfering with the ligand binding properties of other prostanoid...
| Schlagworte: | 5-fluoro-2-methyl-3-(2-quinolinylmethyl)-1H-indole-1-acetic acid |
| Anwendung: | DP2 antagonist |
| CAS | 851723-84-7 |
| MW: | 348.4 D |
ab 94,00 €
