Zu "840506-29-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Acelarin
Artikelnummer: TGM-T4060-100mg
Description: Acelarin (NUC-1031) (NUC-1031) is a ProTide enhancement and transformation of the nucleoside analog, gemcitabine. Target: DNA/RNA Synthesis. Smiles: FC1(F)[C@@H](O[C@H](COP(OC2=CC=CC=C2)(N[C@H](C(OCC3=CC=CC=C3)=O)C)=O)[C@H]1O)N4C(=O)N=C(N)C=C4. References: Slusarczyk M, et al. Application of ProTide...
| Schlagworte: | NUC-1031 |
| Anwendung: | Gemcitabine prodrug |
| CAS | 840506-29-8 |
| MW: | 580.47 D |
ab 40,00 €
NUC-1031
Artikelnummer: Cay9003247-1
NUC-1031 is a prodrug form of the anticancer nucleoside analog gemcitabine (Cay-11690). NUC-1031 is more lipophilic than gemcitabine and enters cells through passive diffusion. It inhibits the growth of L1210, CEM, MP-2, and BxPC-3 cancer cells in vitro (IC50 = 35, 30, 60, and 40 nM, respectively). NUC-1031 (0.076...
| Schlagworte: | N-(2'-deoxy-2',2'-difluoro-P-phenyl-5'-cytidylyl)-L-alanine, phenylmethyl ester |
| Anwendung: | Gemcitabine prodrug |
| CAS | 840506-29-8 |
| MW: | 580.5 D |
ab 52,00 €
