Zu "81-88-9" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Rhodamine B *Fluorescence reference standard*
Rhodamine B *Fluorescence reference standard*

Artikelnummer: ABD-69

Rhodamine B (also called Rhodamine 610, Basic Violet 10, or C.I. 45170) is used as a fluorescent staining dye, sometimes in combination with auramine O.
Anwendung: Labeling
CAS 81-88-9
114,00 €
Bewerten
Rhodamine B
Rhodamine B

Artikelnummer: CDX-R0003-G100

Rhodamine B is a fluorescent xanthene dye widely used in various applications, including histology, due to its bright red to pink fluorescence when exposed to ultraviolet (UV) light. Rhodamine B is used as a tracer dye in water studies to track the movement of water, determine flow rates, and identify leaks in...
Schlagworte: Tetraetylrhodamine, Basic Violet 10, Brilliant Pink B, C.I. 45170, Rhodamine 610 chloride, Rheonine B,...
Anwendung: Staining, fluorescent xanthene dye
CAS 81-88-9
MW: 479,01 D
ab 97,00 €
Bewerten
Rhodamine B
Rhodamine B

Artikelnummer: TGM-T7975-100mg

Description: Rhodamine B (Brilliant Pink B) is used as a tracer dye in water to determine the rate and direction of flow and transport. Target: Others. Smiles: [Cl-].CCN(CC)c1ccc2c(-c3ccccc3C(O)=O)c3ccc(cc3oc2c1)=[N+](CC)CC. References: Tan D , Bai B , Jiang D , et al. Rhodamine B induces long nucleoplasmic bridges...
Schlagworte: Rhodamine O, Basic Violet 1, Rhodamine B, Brilliant Pink B, Tetraethylrhodamine
CAS 81-88-9
MW: 479.01 D
ab 32,00 €
Bewerten