Zu "80714-61-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Semax
Artikelnummer: TGM-T21268-10mg
Description: Semax is a synthetic peptide analog of adrenocorticotropic hormone (ACTH) that has neuroprotective, analgesic, and anxiolytic properties. Smiles: C([C@H](CC1=CC=CC=C1)NC([C@H](CC2=CN=CN2)NC([C@@H](NC([C@H](CCSC)N)=O)CCC(O)=O)=O)=O)(=O)N3[C@H](C(NCC(=O)N4[C@H](C(O)=O)CCC4)=O)CCC3. References: Bashkatova,...
| CAS | 80714-61-0 |
| MW: | 813.93 D |
ab 334,00 €
Semax
Artikelnummer: Cay27719-1
Semax is a synthetic peptide analog of adrenocorticotropic hormone (ACTH) (4-10) (Cay-27106) that has neuroprotective, analgesic, and anxiolytic properties. In vivo, semax (0.3 mg/kg) reduces cortical nitric oxide (NO) production and the number of neurological disturbances, such as seizures, falling, and twisting,...
| Schlagworte: | ACTH4-7-PGP, L-methionyl-L-alpha-glutamyl-L-histidyl-L-phenylalanyl-L-prolylglycyl-L-proline |
| Anwendung: | Neuroprotective, analgesic, anxiolytic, synthetic (ACTH) (4-10) peptide analog |
| CAS | 80714-61-0 |
| MW: | 813.9 D |
ab 204,00 €
