Zu "80-78-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Solanidine
Artikelnummer: TGM-T12971-10mg
Description: Solanidine, a cholestane alkaloid isolated from potato species [Solanum spp.], exhibits antitumor effects by inhibiting cell proliferation. Target: Others. Smiles: [H][C@]12CC[C@H](C)CN1[C@@]1([H])C[C@@]3([H])[C@]4([H])CC=C5C[C@@H](O)CC[C@]5(C)[C@@]4([H])CC[C@]3(C)[C@@]1([H])[C@@H]2C. References: Zhang...
| CAS | 80-78-4 |
| MW: | 397.64 D |
ab 84,00 €
Solanidine
Artikelnummer: Cay36433-1
Solanidine is a steroidal glycoalkaloid metabolite that has been found in potato (S. tuberosum) and has anticancer and teratogenic activities. It inhibits the growth of HT-29 colon and HepG2 liver cancer cells by 80.9 and 82.2%, respectively, when used at a concentration of 100 µg/ml. Solanidine (176 mg/kg) is...
| Schlagworte: | (-)-Solanidine, 22R,25S-Solanidine, NSC 76025, (3beta)-solanid-5-en-3-ol |
| Anwendung: | Steroidal glycoalkaloid metabolite, anticancer / teratogenic agent |
| CAS | 80-78-4 |
| MW: | 397.6 D |
ab 149,00 €
