Zu "792927-06-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TASIN-1
Artikelnummer: Cay21155-1
TASIN-1 is a small molecule inhibitor that specifically kills cells with adenomatous polyposis coli (APC) truncations (IC50 = 70 nM) but spares cells with wild-type APC. TASIN-1 is effective in vivo, inhibiting tumor growth of colorectal cancer (CRC) cells with truncated APC, but not wild-type CRC cells, in a mouse...
| Schlagworte: | 1'-[(4-methoxyphenyl)sulfonyl]-4-methyl-1,4'-bipiperidine |
| Anwendung: | Colorectal cancer tumor growth inhibitor, APC-truncated cell toxin |
| CAS | 792927-06-1 |
| MW: | 352.5 D |
ab 193,00 €
TASIN-1
Artikelnummer: TGM-T22632-100mg
Description: TASIN-1 is a small molecule inhibitor of mutant adenomatous polyposis coli (APC). Target: APC. Smiles: COc1ccc(cc1)S(=O)(=O)N1CCC(CC1)N1CCC(C)CC1. References: Bai R L, Pettit G R, Hamel E. Binding of dolastatin 10 to tubulin at a distinct site for peptide antimitotic agents near the exchangeable...
| Schlagworte: | 1-[(4-methoxyphenyl)sulfonyl]-4'-methyl-4,1'-bipiperidine |
| Anwendung: | Colorectal cancer tumor growth inhibitor, APC-truncated cell toxin |
| CAS | 792927-06-1 |
| MW: | 352.49 D |
ab 32,00 €
