Zu "790663-33-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PBD-150
Artikelnummer: TGM-T7905-100mg
Description: PBD-150 is an inhibitor of human glutaminyl cyclase (hQC) Y115E-Y117E variant( ki : 490 nM). Target: Beta Amyloid. Smiles: COc1ccc(NC(=S)NCCCn2ccnc2)cc1OC. References: Huang, K.-F, Liaw, S.-S, Huang, W.-L,et al. Structures of Human Golgi-resident Glutaminyl Cyclase and Its Complexes with Inhibitors...
| Anwendung: | Glutaminyl cyclase inhibitor |
| CAS | 790663-33-1 |
| MW: | 320.41 D |
ab 31,00 €
PBD-150
Artikelnummer: Cay36112-10
PBD-150 is an inhibitor of glutaminyl cyclase (Ki = 0.49 µM for the human enzyme). It inhibits the formation of the pyroglutamic acid-containing amyloid-beta (Abeta) peptides pGlu-Abeta (3-40) and pGlu-Abeta (3-42) in HEK293 cells expressing human glutaminyl cyclase and human amyloid precursor protein (APP) with an...
| Schlagworte: | N-(3,4-dimethoxyphenyl)-N'-[3-(1H-imidazol-1-yl)propyl]-thiourea |
| Anwendung: | Glutaminyl cyclase inhibitor |
| CAS | 790663-33-1 |
| MW: | 320.4 D |
ab 58,00 €
