Zu "79-63-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LANOSTEROL
Artikelnummer: TGM-T4970-100mg
Description: Lanosterol (3beta-Hydroxy-8,24-lanostadiene) is a tetracyclic triterpenoid which is the compound from which all steroids are derived. Target: Endogenous Metabolite. Smiles: [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3)[C@H](C)CCC=C(C)C. References: Sinha R , Ahn J ,...
| Schlagworte: | 3beta-Hydroxy-8,24-lanostadiene, 8,24-Lanostadien-3beta-ol |
| Anwendung: | Naturally-occurring sterol |
| CAS | 79-63-0 |
| MW: | 426.72 D |
ab 54,00 €
Lanosterol
Artikelnummer: Cay19521-1
Lanosterol is a naturally-occurring sterol and biosynthetic precursor of several animal, fungal, and protozoan steroids, including cholesterol and ergosterol. Defects in the processing of lanosterol contribute to a wide variety of disorders, including the formation of cataracts. Similarly, certain fungicides act by...
| Schlagworte: | 3beta-hydroxy-8,24-Lanostadiene, 8,24-Lanostadien-3beta-ol, NSC 60677, lanosta-8,24-dien-3beta-ol |
| Anwendung: | Naturally-occurring sterol |
| CAS | 79-63-0 |
| MW: | 426.7 D |
ab 106,00 €
