Zu "76924-95-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-(3-Oxohexanoyl)-DL-homoserine lactone
Artikelnummer: CDX-O0051-M010
White solid. Soluble in chloroform. N-(3-Oxohexanoyl)-DL-homoserine lactone is a small diffusible signaling molecule and is a member of N-acyl-homoserine lactone family. N-acylhomoserine lactones (AHL) are involved in quorum sensing, controlling gene expression, and cellular metabolism. The diverse applications of...
| Schlagworte: | 3-oxo-C6-HSL, 3OC6-HSL, N-(beta-Ketocaproyl)-DL-homoserine lactone |
| Anwendung: | Quorum sensing, Gene expression control, Cellular metabolism |
| CAS | 76924-95-3 |
| MW: | 213,2 D |
ab 77,00 €
N-(Ketocaproyl)-DL-homoserine lactone
Artikelnummer: TGM-T16226-10mg
Description: N-(Ketocaproyl)-DL-homoserine lactone is a quorum sensing (QS) autoinducer and a natural, active ligand of LuxR. Target: Antibacterial. Smiles: CCCC(=O)CC(=O)NC1CCOC1=O. References: Li SZ, et al. Influence of the d/l configuration of N-acyl-homoserine lactones (AHLs) and analogues on their Lux-R...
| Schlagworte: | N-(Ketocaproyl)-D,L-homoserine lactone |
| CAS | 76924-95-3 |
| MW: | 213.23 D |
ab 30,00 €
N-(3-Oxohexanoyl)-DL- homoserine lactone
Artikelnummer: CSB-DT2615.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 76924-95-3 |
| MW: | 213.233 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
