Zu "76-75-5" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thiopental
Artikelnummer: Cay22021-1
An analytical reference standard categorized as a barbiturate, has anesthetic and anti-convulsant effects in rats, regulated as a Schedule III compound in the United States, intended for research and forensic applications. SMILES: O=C1C(CC)(C(C)CCC)C(NC(N1)=S)=O. InChi Code:...
| Schlagworte: | Thiopentone, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione |
| Anwendung: | Analytical reference standard, barbiturate |
| CAS | 76-75-5 |
| MW: | 242.3 D |
ab 35,00 €
