Zu "757942-88-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
Acetyl tetrapeptide-2
Artikelnummer: TGM-TP2363-500mg
Description: Acetyl tetrapeptide-2 is a skin conditioner, by soothing and nourishing the skin through similar mechanisms as other peptides. Smiles: CC(C)[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCCCN)NC(C)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O. References: Raters M, Elsinghorst PW, Goetze S, Dingel A, Matissek R....
| Schlagworte: | Thymulen 4, Peptigravity |
| CAS | 757942-88-4 |
| MW: | 565.62 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Acetyl Tetrapeptide-2
Artikelnummer: CSB-DT1717.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Ac-Lys-Asp-Val-Tyr, Ac-KDVY |
| Anwendung: | Cosmetic peptide |
| CAS | 757942-88-4 |
| MW: | 565.6 D |
210,00 €
