Zu "7497-07-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NSC 405020
Artikelnummer: Cay14859-1
NSC 405020 binds to the hemopexin (PEX) domain of the membrane type-1 matrix metalloproteinase (MT1-MMP/MMP-14). It disrupts MT1-MMP homodimerization without affecting its catalytic activity in an assay using the MT1-MMP CAT domain, which is involved in its tumor promoting function (IC50 > 100 µM). In a mouse tumor...
| Schlagworte: | 3,4-dichloro-N-(1-methylbutyl)-benzamide |
| Anwendung: | MT1-MMP inhibitor |
| CAS | 7497-07-6 |
| MW: | 260.2 D |
ab 51,00 €
NSC 405020
Artikelnummer: TGM-T1891-100mg
Description: NSC 405020 is a noncatalytic inhibitor of MT1-MMP. Target: MMP. Smiles: CCCC(C)NC(=O)C1=CC=C(Cl)C(Cl)=C1. References: Remacle GG, et al. Cancer Res, 2012, 72(9), 2339-49.
| Anwendung: | MT1-MMP inhibitor |
| CAS | 7497-07-6 |
| MW: | 260.16 D |
ab 29,00 €
