Zu "74863-84-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Argatroban
Artikelnummer: TGM-T0155-100mg
Description: Argatroban (MCI-9038), a specific thrombin inhibitor, which is a non-heparin anticoagulant, prevents the formation of thrombi. Target: Thrombin. Smiles: S(N[C@H](C(=O)N1[C@@H](C(O)=O)C[C@H](C)CC1)CCCNC(=N)N)(=O)(=O)C2=C3C(=CC=C2)CC(C)CN3. References: Berry CN, et al. Br J Pharmacol,1994, 113(4), 1209-1214.
| Schlagworte: | MD-805, Argipidine, MCI-9038 |
| CAS | 74863-84-6 |
| MW: | 508.63 D |
ab 34,00 €
Argatroban
Artikelnummer: LKT-A6823.10
Solid. A thrombin inhibitor that prevents tumor cell migration and bone metastasis. It has been shown to be more effective than heparin in preventing platelet loss and expression of P-selectin.
| Schlagworte: | Argatrobanum |
| Anwendung: | Thrombin inhibitor |
| CAS | 74863-84-6 |
| MW: | 508,64 D |
ab 94,00 €
Argatroban
Artikelnummer: Cay19639-25
Argatroban is a reversible inhibitor of thrombin (IC50s = 0.01 and 0.09 µM for the free and clot-bound forms, respectively). It is selective for thrombin over factor Xa, trypsin, plasmin, and tissue plasminogen activator (Kis = 0.0045, 53, 0.19, 25.7, and 87.7 µM, respectively). It inhibits thrombin-induced platelet...
| Schlagworte: | MCI-9038,... |
| Anwendung: | Reversible, competitive thrombin inhibitor |
| CAS | 74863-84-6 |
| MW: | 508.6 D |
ab 52,00 €
