Zu "745055-91-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UBP 302
Artikelnummer: TGM-T17193-1mg
Description: UBP 302 is an effective and selective GLUK5-subunit-containing kainate receptor antagonist (apparent Kd=402 nM) and displays very little affinity on GluK2 kainate receptors. Target: Others. Smiles: N[C@@H](Cn1ccc(=O)n(Cc2ccccc2C(O)=O)c1=O)C(O)=O
| Anwendung: | GluR5 antagonist |
| CAS | 745055-91-8 |
| MW: | 333.3 D |
142,00 €
UBP 302
Artikelnummer: Cay24309-1
UBP 302 is an antagonist of glutamate receptor 5 (GluR5) subunit-containing kainate receptors that inhibits kainate-induced responses in isolated rat dorsal roots (Kd = 402 nM). In vitro, UBP 302 inhibits gamma frequency oscillations in the rat basolateral amygdala at a concentration of 25 µM, and blocks kainate...
| Schlagworte: | alphaS-amino-3-[(2-carboxyphenyl)methyl]-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinepropanoic acid |
| Anwendung: | GluR5 antagonist |
| CAS | 745055-91-8 |
| MW: | 333.3 D |
ab 78,00 €
