Zu "742112-33-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
OSU03012
Artikelnummer: Cay10008005-10
Cyclooxygenase-2 (COX-2) appears to play a significant role in the development and progression of cancer and COX-2 inhibitors such as celecoxib exhibit anti-cancer activity. OSU03012 is an analog of celecoxib that exhibits anti-cancer activity in a COX-2-independent manner via inhibition of the phosphatidyl...
| Schlagworte: | 2-amino-N-[4-[5-(2-phenanthrenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl]-acetamide |
| Anwendung: | PDK1 (PDPK1) inhibitor |
| CAS | 742112-33-0 |
| MW: | 460.5 D |
ab 100,00 €
Osu03012
Artikelnummer: TGM-T2466-100mg
Description: Osu03012 (AR-12) is an orally bioavailable, small-molecule, celecoxib-derived inhibitor of phosphoinositide-dependent kinase-1 (PDK1) with potential antineoplastic activity. Target: PDK. Smiles: NCC(=O)Nc1ccc(cc1)-n1nc(cc1-c1ccc2c(ccc3ccccc23)c1)C(F)(F)F. References: Zhu J, et al. Cancer Res, 2004,...
| Schlagworte: | Osu 03012, Osu-03012, AR-12 |
| Anwendung: | PDK1 (PDPK1) inhibitor |
| CAS | 742112-33-0 |
| MW: | 460.45 D |
ab 31,00 €
