Zu "73465-43-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1-Deoxymannojirimycin (hydrochloride)
Artikelnummer: Cay17178-1
1-Deoxymannojirimycin is a specific inhibitor of class I alpha-1,2-mannosidase (IC50 = 0.02 µM), a key enzyme for N-glycan processing in the endoplasmic reticulum and Golgi and for targeting misfolded proteins for translocation out of the endoplasmic reticulum and degradation by the proteasome. By inhibiting...
| Schlagworte: | 2R-(hydroxymethyl)-3R,4R,5R-piperidinetriol, monohydrochloride |
| Anwendung: | alpha-1,2-mannosidase inhibitor |
| CAS | 73465-43-7 |
| MW: | 199.6 D |
ab 44,00 €
1-Deoxymannojirimycin hydrochloride
Artikelnummer: TGM-T22468-10mg
Description: 1-Deoxymannojirimycin hydrochloride, a selective alpha1,2-mannosidase inhibitor (IC50: 20 µM), also inhibits HIV-1 strains but exhibits poor antiviral activity. Target: HIV Protease, Influenza Virus, Others. Smiles: Cl.OC[C@H]1NC[C@@H](O)[C@@H](O)[C@@H]1O. References: Jan Balzarini, et al. The...
| Anwendung: | alpha-1,2-mannosidase inhibitor |
| CAS | 73465-43-7 |
| MW: | 199.63 D |
ab 93,00 €
