Zu "729607-74-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
HIV-1 Integrase Inhibitor 1
Artikelnummer: Cay36807-10
HIV-1 integrase inhibitor 1 is an inhibitor of HIV-1 integrase DNA strand transfer (IC50 = 14 nM). It is also an inhibitor of severe acute respiratory syndrome coronavirus 2 (SARS-CoV-2) main protease (Mpro), also known as 3C-like protease (3CLpro), when used at a concentration of 10 µM in a fluorescence-based...
| Schlagworte: | BMS-707035,... |
| Anwendung: | HIV-1 integrase DNA strand transfer inhibitor |
| CAS | 729607-74-3 |
| MW: | 410.4 D |
ab 190,00 €
BMS-707035
Artikelnummer: TGM-T6420-100mg
Description: BMS-707035 is a specific HIV-I integrase (IN) inhibitor with IC50 of 15 nM. Phase 2. Target: HIV Protease. Smiles: Cn1c(nc(C(=O)NCc2ccc(F)cc2)c(O)c1=O)N1CCCCS1(=O)=O. References: Langley DR, et al. Biochemistry, 2008, 47(51), 13481-13488.
| Anwendung: | HIV-1 integrase DNA strand transfer inhibitor |
| CAS | 729607-74-3 |
| MW: | 410.42 D |
ab 39,00 €
