Zu "72909-34-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pyrroloquinoline quinone
Artikelnummer: TGM-T5692-100mg
Description: Pyrroloquinoline quinone (PQQ), as a well-known redox enzyme cofactor, PQQ can protect NS/PCs against glutamate toxicity associated with ROS-mediated mitochondrial pathway,. Target: Endogenous Metabolite, Others. Smiles: OC(=O)C1=CC2=C(N1)C1=C(C=C(N=C1C(=O)C2=O)C(O)=O)C(O)=O. References: Guan S , Xu J...
| CAS | 72909-34-3 |
| MW: | 330.21 D |
60,00 €
Pyrroloquinoline quinone
Artikelnummer: Cay20681-1
Pyrroloquinoline quinone (PQQ) is a quinone and redox enzyme cofactor that has been found in a variety of bacteria and has diverse biological activities. It inhibits fibril formation by the amyloid proteins amyloid-beta (1-42) (Abeta42) and mouse prion protein when used at a concentrations of 100 and 300 µM. PQQ...
| Schlagworte: | PQQ, 4,5-dihydro-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
| Anwendung: | Redox enzyme cofactor |
| CAS | 72909-34-3 |
| MW: | 330.2 D |
ab 34,00 €
