Zu "724708-21-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Chk2 Inhibitor
Artikelnummer: Cay21184-1
Chk2 inhibitor is an inhibitor of checkpoint kinase 2 (Chk2, IC50 = 13.5 nM). It is selective for Chk2 over Chk1 (IC50 = 220.4 nM). It inhibits Chk2 autophosphorylation at the serine in position 516 in non-cancerous 184B5 cells that contain wild-type p53 and in MDA-MB-231 cells that contain mutated p53 when used at...
| Schlagworte: | SC-203885, (5Z)-5-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-3,4,5,10-tetrahydro-azepino[3,4-b]indol-1(2H)-one |
| Anwendung: | CHEK2 inhibitor |
| CAS | 724708-21-8 |
| MW: | 295.3 D |
ab 360,00 €
SC-203885
Artikelnummer: TGM-T24768-1mg
Description: SC-203885 is a checkpoint kinase 2 inhibitor. Target: Others. Smiles: O=C1C2=C(/C(/CCN1)=C\3/C(=O)N=C(N)N3)C=4C(N2)=CC=CC4
| Schlagworte: | SC 203885, SC203885 |
| Anwendung: | CHEK2 inhibitor |
| CAS | 724708-21-8 |
| MW: | 295.3 D |
ab 812,00 €
