Zu "722456-31-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
VAS2870
Artikelnummer: TGM-T4359-100mg
Description: VAS2870 is an inhibitor of NADPH oxidase (NOX). Target: NADPH. Smiles: C(c1ccccc1)n1nnc2c(Sc3nc4ccccc4o3)ncnc12. References: ten Freyhaus H, et al. Novel Nox inhibitor VAS2870 attenuates PDGF-dependent smooth muscle cell chemotaxis, but not proliferation. Cardiovasc Res. 2006 Jul 15,71(2):331-41.
| Anwendung: | Cell-permeable specific NADPH oxidase inhibitor |
| CAS | 722456-31-7 |
| MW: | 360.39 D |
ab 52,00 €
VAS2870
Artikelnummer: Cay19205-1
VAS2870 is a selective inhibitor of the NADPH oxidases. Pre-incubation of rat vascular smooth muscle cells with VAS2870 abolishes platelet-derived growth factor-dependent chemotaxis without affecting cell cycle progression (IC50 = 10 µM). At low (2.8 mM), but not high (16.7 mM), concentrations of glucose, treatment...
| Schlagworte: | 7-(2-benzoxazolylthio)-3-(phenylmethyl)-3H-1,2,3-triazolo[4,5-d]pyrimidine |
| Anwendung: | Cell-permeable specific NADPH oxidase inhibitor |
| CAS | 722456-31-7 |
| MW: | 360.4 D |
ab 44,00 €
