Zu "720690-73-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK189254A
Artikelnummer: TGM-TQ0066-100mg
Description: GSK189254A (GSK189254) is a potent and specific histamine H3 receptor antagonist (pKi values: 9.59-9.90 and 8.51-9.17 for human and rat H3). Target: Histamine Receptor. Smiles: CNC(=O)c1ccc(Oc2ccc3CCN(CCc3c2)C2CCC2)nc1. References: Medhurst AD, et al. GSK189254, a novel H3 receptor antagonist that binds...
| Schlagworte: | GSK189254 |
| Anwendung: | Histamine H3 receptor antagonist |
| CAS | 720690-73-3 |
| MW: | 351.44 D |
ab 48,00 €
GSK189254
Artikelnummer: Cay36705-10
GSK189254 is a histamine H3 receptor antagonist (Kis = 0.13, 0.68, and 1.74 nM for the recombinant human, rat, and mouse receptors, respectively). It is selective for the histamine H3 receptor over a panel of 50 receptors and ion channels at 1 µM. GSK189254 prevents imetit-induced decreases in forskolin-stimulated...
| Schlagworte: | GSK189254A, 6-[(3-cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl-3-pyridinecarboxamide |
| Anwendung: | Histamine H3 receptor antagonist |
| CAS | 720690-73-3 |
| MW: | 351.4 D |
ab 150,00 €
