Zu "7184-60-3" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Borrelidin
Artikelnummer: TGM-T10582-1mg
Description: Borrelidin (Treponemycin) is a macrolide antibiotic isolated from *Streptomyces rochei*, acting as a threonyl-tRNA synthetase inhibitor in both bacterial and eukaryal systems. Target: Others. Smiles: CC1CC(C)CC(C)C(O)C(=CC=CCC(OC(=O)CC(O)C(C)C1)C1CCCC1C(O)=O)C#N. References: Habibi D, et al. Borrelidin,...
| Schlagworte: | Treponemycin |
| CAS | 7184-60-3 |
| MW: | 489.64 D |
ab 198,00 €
Borrelidin
Artikelnummer: Cay14436-1
Borrelidin is a secondary metabolite produced by Streptomyces and other bacteria. It displays potent antiangiogenic activity, preventing tube formation in rat aorta explants (IC50 = 0.8 nM) and inducing apoptosis in endothelial cells. Borrelidin also alters the splicing of VEGF mRNA, producing an antiangiogenic...
| Schlagworte: | NSC 216128, Treponemycin,... |
| Anwendung: | Threonyl tRNA synthetase inhibitor |
| CAS | 7184-60-3 |
| MW: | 489.6 D |
ab 111,00 €
Borrelidin
Artikelnummer: LKT-B5870.1
Borrelidin is a macrolide antibiotic produced by Streptomyces. Borrelidin exhibits anti-parasitic, antifungal, anticancer, and anti-angiogenic activities. This compound inhibits threonyl-tRNA synthetase/ligase, inhibiting growth and survival of Trypanosoma, Plasmodium, and Phytophthora. In acute lymphocytic leukemia...
| Anwendung: | Macrolide antibiotic, TARS inhibitor |
| CAS | 7184-60-3 |
| MW: | 489.64 D |
ab 476,00 €
Borrelidin
Artikelnummer: BVT-0098-C500
Macrolide antibiotic, Bacterial and eukaryal threonyl-tRNA synthetase (THrRS) inhibitor, Antiangiogenic (IC50 = 0.8 nM), Induces the collapse of formed capillary tubes in a dose-dependent fashion, In HUVECs, the capillary tube collapsing activity is mediated by the activation of caspases-3 and -8 and induction of...
| Schlagworte: | Treponemycin, U 78548, C2989 |
| Anwendung: | Threonyl-tRNA synthetase (THrRS) inhibitor |
| CAS | 7184-60-3 |
| MW: | 489,6 D |
ab 85,00 €
