Zu "717824-30-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vidofludimus
Artikelnummer: Cay18377-10
Dihydroorotate dehydrogenase (DHODH) is involved in pyrimidine nucleoside biosynthesis. DHODH inhibitors have value in autoimmune diseases as well as cancer and certain infections. Vidofludimus is an immunosuppressive drug that inhibits DHODH (IC50s = 0.134, 1.29, and 10.6 µM for human, rat, and mouse isoforms,...
| Schlagworte: | 4SC-101, 2-[[(3-fluoro-3'-methoxy[1,1'-biphenyl]-4-yl)amino]carbonyl]-1-cyclopentene-1-carboxylic acid |
| Anwendung: | Dihydroorotate dehydrogenase (DHODH) inhibitor |
| CAS | 717824-30-1 |
| MW: | 355.4 D |
ab 52,00 €
Vidofludimus
Artikelnummer: TGM-T2601-100mg
Description: Vidofludimus (SC12267) (4SC-101, SC12267) is a novel small molecule inhibitor of dihydroorotate dehydrogenase (DHODH). Target: DNA/RNA Synthesis, Dehydrogenase, Interleukin. Smiles: COc1cccc(c1)-c1ccc(NC(=O)C2=C(CCC2)C(O)=O)c(F)c1. References: Kulkarni OP, et al. Am J Pathol. 2010, 176(6), 2840-2847.
| Schlagworte: | 4sc-101, SC12267 |
| Anwendung: | Dihydroorotate dehydrogenase (DHODH) inhibitor |
| CAS | 717824-30-1 |
| MW: | 355.36 D |
ab 55,00 €
