Zu "71595-19-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tolmetin beta-D-Glucuronide
Artikelnummer: Cay22161-1
Tolmetin beta-D-glucuronide is a major phase II metabolite of tolmetin (Cay-18195). Tolmetin beta-D-glucuronide has been classified into a 'warning' category in terms of its potential to cause idiosyncratic drug toxicity, based on its half-life in several in vitro systems.Formal Name:...
| Schlagworte: | 1-[1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate] beta-D-glucopyranuronic acid |
| Anwendung: | Metabolite |
| CAS | 71595-19-2 |
| MW: | 433.4 D |
371,00 €
Tolmetin beta-D-Glucuronide
Artikelnummer: TGM-T36128-1mg
Description: Tolmetin beta-D-Glucuronide has reactive properties with human serum albumin, allowing identification of the binding site and reaction mechanism by tandem mass spectrometry. Target: Others. Smiles: C(=O)(C=1N(C)C(CC(O[C@@H]2O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]2O)=O)=CC1)C3=CC=C(C)C=C3
| CAS | 71595-19-2 |
| MW: | 433.41 D |
559,00 €
