Zu "71555-25-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NSC 319726
Artikelnummer: Cay23701-5
NSC 319726 is a reactivator of p53R175, a p53 conformational mutant that cannot bind DNA. It selectively inhibits growth of human tumor cell lines containing mutant p53 over those containing wild-type p53 (IC50s = 0.1-1 and >10 µM, respectively). NSC 319726 induces apoptosis in TOV112D (p53R175H), but not OVCAR3...
| Schlagworte: | 2-[1-(2-pyridinyl)ethylidene]hydrazide, 1-azetidinecarbothioic acid |
| Anwendung: | p53-R175 reactivator |
| CAS | 71555-25-4 |
| MW: | 234.3 D |
ab 145,00 €
ZMC1
Artikelnummer: TGM-T2464-100mg
Description: NSC-319726 (ZMC1), a mutant p53R175 reactivator, suppresses growth of fibroblasts that expresses the p53R175 mutation (IC50 = 8 nM). Target: p53. Smiles: C\C(=N/NC(=S)N1CCC1)c1ccccn1. References: Yu X, et al. Cancer Cell, 2012, 21(5), 614-625.
| Anwendung: | p53-R175 reactivator |
| CAS | 71555-25-4 |
| MW: | 234.32 D |
ab 31,00 €
