Zu "7073-61-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cholesterol beta-D-Glucoside
Artikelnummer: TGM-T38045-1mg
Description: Cholesterol beta-D-Glucoside (beta-D-Glucopyranoside) is a toxicant produced by the human parasite Helicobacter pylori. Smiles: C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])(CC=C1C[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)CC2)[H])[H]
| Schlagworte: | (3beta)-cholest-5-en-3-yl, beta-D-Glucopyranoside |
| CAS | 7073-61-2 |
| MW: | 548.79 D |
190,00 €
Cholesterol beta-D-Glucoside
Artikelnummer: Cay26713-1
Cholesterol beta-D-glucoside is a derivative of cholesterol that contains beta-D-glucose (Cay-16775). It is formed from cholesterol and glucosylceramide by beta-glucosidase 1. It activates heat shock transcription factor 1 (Hsf1) in response to heat shock, which increases the expression of heat shock protein 70...
| Schlagworte: | Cholesteryl Glucoside, GluChol, Glucosyl Cholesterol, beta-ChlGlc, cholest-5-en-3beta-yl, beta-D-glucopyranoside |
| Anwendung: | Cholesterol derivative |
| CAS | 7073-61-2 |
| MW: | 548.8 D |
ab 77,00 €
