Zu "70363-83-6" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
DiBAC4(3) (Bis-(1,3-dibutylbarbituric acid)trimethine oxonol)
DiBAC4(3) (Bis-(1,3-dibutylbarbituric acid)trimethine...

Artikelnummer: ABD-21411

DiBAC4(5) is a sensitive membrane potential probe. Slow-response probes are suitable for detecting changes in average membrane potentials of nonexcitable cells.
Anwendung: Membrane potential probe
CAS 70363-83-6
145,00 €
Bewerten
DiBAC4(3)
DiBAC4(3)

Artikelnummer: Cay33924-5

DiBAC4(3) is a negatively charged fluorescent membrane potential indicator. Upon membrane depolarization, DiBAC4(3) enters the cytosol, binds to lipid membranes and intracellular proteins, and displays excitation/emission maxima of 490/516 nm, respectively. It has been used to measure the membrane potential of live...
Schlagworte: Bis(1,3-Dibutylbarbituric Acid) Trimethine Oxonol,...
Anwendung: Fluorescent membrane potential indicator, FC, FM
CAS 70363-83-6
MW: 516.6 D
ab 84,00 €
Bewerten
DiBAC4(3)
DiBAC4(3)

Artikelnummer: TGM-T18974-100mg

Description: DiBAC4(3) is a voltage-sensitive fluorescent dye (lambdaem=505 nm, lambdaex=490 nm). Target: Others. Smiles: CCCCN1C(=O)C(\C=C\C=C2C(=O)N(CCCC)C(=O)N(CCCC)C2=O)C(=O)N(CCCC)C1=O. References: Yamada A, et al. Usefulness and limitation of DiBAC4(3), a voltage-sensitive fluorescent dye, for the measurement...
CAS 70363-83-6
MW: 516.63 D
ab 54,00 €
Bewerten