Zu "702674-56-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BX-912
Artikelnummer: TGM-T1837-100mg
Description: BX-912 is a specific inhibitor of 3-Phosphoinositide-dependent Kinase-1 (PDK1, IC50: 12 nM). The selectivity of BX-912 is more 10 fold than C-Kit, EGFR, PKA, PKC etc. Target: VEGFR, PKA, PDK, Apoptosis, Chk, CDK. Smiles: Brc1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCc1cnc[nH]1. References: Feldman RI, et...
| Anwendung: | PDK1 inhibitor |
| CAS | 702674-56-4 |
| MW: | 471.35 D |
ab 48,00 €
BX-912
Artikelnummer: Cay14708-1
3-Phosphoinositide-dependent protein kinase 1 (PDK1) is a serine-threonine kinase that phosphorylates and activates a range of other kinases, including protein kinase (PK)B, PKA, and certain isoforms of PKC. BX-912 is a potent, ATP-competitive inhibitor of PDK1 (IC50 = 26 nM). It less effectively inhibits a panel of...
| Schlagworte: | N-[3-[[5-bromo-4-[[2-(1H-imidazol-5-yl)ethyl]amino]-2-pyrimidinyl]amino]phenyl]-1-pyrrolidinecarboxamide |
| Anwendung: | PDK1 inhibitor |
| CAS | 702674-56-4 |
| MW: | 471.4 D |
ab 62,00 €
BX-912
Artikelnummer: SYN-1027-M001
Soluble in DMSO or ethanol. BX912 is a PDK1 (3-Phosphoinositide-dependent Kinase-1) inhibitor, with an IC(50) of 26nM. Target: PDK1 , Kinase Group: AGC , Substrate: Serine-Threonine
| Schlagworte: | BX912 |
| Anwendung: | PDPK1 inhibitor |
| CAS | 702674-56-4 |
| MW: | 471,4 D |
ab 100,00 €
