Zu "69657-51-8" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Acyclovir sodium
Acyclovir sodium

Artikelnummer: TGM-T1454L-100mg

Description: Acyclovir sodium is an antimetabolite. Acyclovir sodium inhibits HSV-specified DNA polymerases and prevents further viral DNA synthesis. Target: Others. Smiles: [Na+].Nc1nc([O-])c2ncn(COCCO)c2n1. References: Caviness AC, Demmler GJ, Swint JM, Cantor SB. Cost-effectiveness analysis of herpes simplex...
Schlagworte: Aciclovir sodium
Anwendung: Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38)
CAS 69657-51-8
MW: 248.19 D
ab 71,00 €
Bewerten