Zu "69567-11-9" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Deoxynojirimycin Tetrabenzyl Ether
Deoxynojirimycin Tetrabenzyl Ether

Artikelnummer: Cay10011914-10

Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II.Formal Name: 3R,4R,5S-tris(phenylmethoxy-2R-[(phenylmethoxy)methyl]-piperidine. CAS Number: 69567-11-9. Synonyms: DNJ...
Schlagworte: dNM Tetrabenzyl Ether, 3R,4R,5S-tris(phenylmethoxy-2R-[(phenylmethoxy)methyl]-piperidine
Anwendung: Alpha-glucosidase inhibitor
CAS 69567-11-9
MW: 523.7 D
ab 111,00 €
Bewerten
Deoxynojirimycin Tetrabenzyl Ether
Deoxynojirimycin Tetrabenzyl Ether

Artikelnummer: TGM-T37903-10mg

Description: Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II. Target: Others. Smiles: C(OCc1ccccc1)[C@H]1NC[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1
Anwendung: Alpha-glucosidase inhibitor
CAS 69567-11-9
MW: 523.673 D
ab 253,00 €
Bewerten