Zu "69123-98-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fialuridine
Artikelnummer: Cay15867-5
Fialuridine (FIAU) is a nucleoside analog with antiviral activity. It inhibits thymidine kinases from herpes simplex virus types 1 and 2 with Ki values of 0.14 and 0.95 µM, respectively, while blocking green monkey Vero cell thymidine kinase less effectively (Ki = 53 µM). FIAU blocks DNA synthesis in human...
| Schlagworte: | 5-Iodo-2'-Fluoroarauracil, FIAU, Fluoroiodoarauracil, NSC 678514,... |
| Anwendung: | Antiviral nucleoside analog |
| CAS | 69123-98-4 |
| MW: | 372.1 D |
ab 49,00 €
Fialuridine
Artikelnummer: TGM-T7655-100mg
Description: Fialuridine (DRG-0098) is a DNA-directed DNA polymerase inhibitor potentially for the treatment of HBV infection with potent activity against hepatitis B virus in vitro and in vivo. Target: DNA/RNA Synthesis. Smiles: OC[C@H]1O[C@H]([C@@H](F)[C@@H]1O)n1cc(I)c(=O)[nH]c1=O. References: Colacino J M , Lopez...
| Schlagworte: | FIAU, DRG-0098 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 69123-98-4 |
| MW: | 372.09 D |
ab 30,00 €
