Zu "688353-45-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IWP-12
Artikelnummer: Cay22729-1
IWP-12 is a small molecule inhibitor of porcupine (PORCN), which is an acyltransferase that palmitoylates and activates Wnt proteins. IWP-12 inhibits cell-autonomous Wnt signaling with an IC50 value of 15 nM.Formal Name:...
| Schlagworte: | Inhibitor of Wnt Production-12,... |
| Anwendung: | Protein-serine O-palmitoleoyltransferase porcupine (PORCN) inhibitor |
| CAS | 688353-45-9 |
| MW: | 418.6 D |
ab 49,00 €
IWP 12
Artikelnummer: TGM-T22875-10mg
Description: IWP 12 is a highly efficient Porcupine (Porcn) inhibitor that inhibits the Wnt signaling pathway, blocking tail fin regeneration in both adult and juvenile fish. Target: Acyltransferase, Porcupine. Smiles: O=C1C=2SC(C)CC2N=C(SCC(=O)NC3=NC=4C=CC(=CC4S3)C)N1C
| Schlagworte: | IWP12 |
| CAS | 688353-45-9 |
| MW: | 418.56 D |
ab 43,00 €
