Zu "68359-37-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cyfluthrin
Artikelnummer: TGM-T37688-100mg
Description: Cyfluthrin binds to voltage-sensitive sodium channel such as Nav 1.8 sodium channel and modify their gating kinetics, thereby disrupting nerve function of pests. Target: Reactive Oxygen Species, Sodium Channel. Smiles: C(OC(C#N)C1=CC(OC2=CC=CC=C2)=C(F)C=C1)(=O)C3C(C=C(Cl)Cl)C3(C)C. References:...
| Anwendung: | Insecticide (veterinary) |
| CAS | 68359-37-5 |
| MW: | 434.29 D |
ab 49,00 €
Cyfluthrin
Artikelnummer: Cay24231-100
Cyfluthrin is a pyrethroid insecticide and a modulator of voltage-gated sodium channels (Nav). It slowly activates rat recombinant Nav1.8 channels, delays inactivation by longer than 40 ms, and induces persistent tail currents in channels expressed in X. laevis oocytes. It also decreases the mean burst rate in rat...
| Schlagworte: | beta-Cyfluthrin, 3-(2,2-dichloroethenyl)-2,2-dimethyl-cyclopropanecarboxylic acid, cyano(4-fluoro-3-phenoxyphenyl)methyl... |
| Anwendung: | Insecticide, voltage-gated sodium channel modulator |
| CAS | 68359-37-5 |
| MW: | 434.3 D |
52,00 €
