Zu "676596-65-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1-Azakenpaullone
Artikelnummer: TGM-T6358-100mg
Description: 1-Azakenpaullone (azakenpaullone) is a potent and selective GSK-3beta inhibitor with IC50 of 18 nM, >100-fold selectivity over CDK1/cyclin B and CDK5/p25. Target: GSK-3. Smiles: Brc1ccc2[nH]c-3c(CC(=O)Nc4cccnc-34)c2c1. References: Kunick C, et al. Bioorg Med Chem Lett. 2004, 14(2), 413-416.
| Schlagworte: | azakenpaullone |
| Anwendung: | GSK-3beta inhibitor |
| CAS | 676596-65-9 |
| MW: | 328.16 D |
ab 72,00 €
1-Azakenpaullone
Artikelnummer: Cay16733-1
1-Azakenpaullone is an analog of kenpaullone (Cay-10010239) that inhibits glycogen synthase kinase 3beta (GSK3beta) more potently (IC50 = 18 nM) than CDK1/cyclin B or CDK5/p25 (IC50s = 2.0 and 4.2 µM, respectively). Through its effects on GSK3beta, 1-azakenpaullone stimulates the proliferation of human pancreatic...
| Schlagworte: | 9-bromo-7,12-dihydro-pyrido[3',2':2,3]azepino[4,5-b]indol-6(5H)-one |
| Anwendung: | GSK3beta inhibitor |
| CAS | 676596-65-9 |
| MW: | 328.2 D |
ab 126,00 €
1-Azakenpaullone
Artikelnummer: AG-CR1-0035-M005
Potent and ATP-competitive GSK-3beta (glycogen synthase kinase-3beta) inhibitor (IC50 = 18 nM).
| Schlagworte: | 9-Bromo-7,12-dihydropyrido[3',2':2,3]azepino[4,5-b]indol-6(5H)-one |
| Anwendung: | GSK-3beta inhibitor |
| CAS | 676596-65-9 |
| MW: | 328,2 D |
ab 88,00 €
