Zu "67469-45-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GBR 13069 (hydrochloride)
Artikelnummer: Cay38903-10
GBR 13069 is a dopamine uptake inhibitor. It selectively inhibits dopamine uptake over norepinephrine uptake in rat occipital cortex slices (IC50s = 40 and 800 nM, respectively). GBR 13069 (2.5, 5, and 10 mg/kg) induces ipsilateral rotation and increases locomotion in rats. It also prevents 2'-CH3-MPTP-induced...
| Schlagworte: | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenyl-2-propen-1-yl)-piperazine, dihydrochloride |
| Anwendung: | Dopamine uptake inhibitor |
| CAS | 67469-45-8 |
| MW: | 521.5 D |
ab 111,00 €
GBR 13069 dihydrochloride
Artikelnummer: TGM-T22799-10mg
Description: GBR 13069 dihydrochloride is a dopamine uptake inhibitor. Target: Others. Smiles: FC1=CC=C(C(C2=CC=C(C=C2)F)OCCN3CCN(CC3)CC=CC4=CC=CC=C4)C=C1.Cl.Cl
| CAS | 67469-45-8 |
| MW: | 521.47 D |
ab 198,00 €
