Zu "67287-39-2" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
(±)-SKF 81297 (hydrobromide)
(±)-SKF 81297 (hydrobromide)

Artikelnummer: Cay15067-10

(±)-SKF 81297 is a selective agonist of the dopamine D1-like receptor (Ki = 1.9 nM). It demonstrates comparatively lower binding affinity for the dopamine D2, dopamine D3, serotonin 5-HT2A, and adrenergic alpha2 receptors (Kis = 1,272, >10,000, 955, and 509 nM, respectively). Activation of dopamine D1-like receptors...
Schlagworte: (±)-6-chloro-PB, 6-chloro-2,3,4,5-tetrahydro-1-phenyl-1H-3-benzazepine-7,8-diol, monohydrobromide
Anwendung: Dopamine D1-like receptor agonist
CAS 67287-39-2
MW: 370.7 D
ab 145,00 €
Bewerten
SKF 81297 hydrobromide
SKF 81297 hydrobromide

Artikelnummer: TGM-T23361-100mg

Description: SKF 81297 hydrobromide is a Dopamine D1-like receptor agonist. Target: Others. Smiles: Br.Oc1cc2C(CNCCc2c(Cl)c1O)c1ccccc1
CAS 67287-39-2
MW: 370.67 D
ab 212,00 €
Bewerten