Zu "66513-28-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Indanomycin
Artikelnummer: Cay21761-1
Indanomycin is an antibiotic of the pyrroloketoindane class, which includes an unusual indane ring structure. It has bactericidal activity against Gram-positive bacteria, with minimum inhibitory concentration (MIC) values of =0.2 µg/ml.Formal Name:...
| Schlagworte: | X 14547A,... |
| Anwendung: | Antibiotic |
| CAS | 66513-28-8 |
| MW: | 493.7 D |
ab 366,00 €
X 14547-A
Artikelnummer: TGM-T35149-1mg
Description: X 14547-A is a biochemical product. Target: Others. Smiles: [H][C@@]12CC[C@H](CC)[C@@]1([H])C=C[C@]([H])(\C=C\C=C(/CC)[C@]1([H])O[C@]([H])(CC[C@@H]1C)[C@@H](C)C(O)=O)[C@@]2([H])C(=O)c1ccc[nH]1. References: Gärtner M, Satyanarayana G, Förster S, Helmchen G. Syntheses of the hexahydroindene cores of...
| Schlagworte: | X 14547 |
| CAS | 66513-28-8 |
| MW: | 493.68 D |
565,00 €
