Zu "66508-37-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fosmidomycin (sodium salt)
Artikelnummer: Cay16000-5
Fosmidomycin is an antibiotic originally isolated from culture broths of bacteria of the genus Streptomyces that inhibits DOXP reductoisomerase, a key enzyme in the non-mevalonate pathway of isoprenoid biosynthesis. Fosmidomycin is active against both Gram-negative and Gram-positive bacteria and the human malarial...
| Schlagworte: | Antibiotic FR31564, FR31564, P-[3-(formylhydroxyamino)propyl]-phosphonic acid, monosodium salt |
| Anwendung: | Antibiotic, DOXP reductoisomerase inhibitor |
| CAS | 66508-37-0 |
| MW: | 205.1 D |
ab 69,00 €
Fosmidomycin sodium salt
Artikelnummer: TGM-T11315-1mg
Description: Fosmidomycin sodium salt (FR-31564 sodium salt) is an anti-infective antibiotic with anti-malarial activity that inhibits both Gram-negative and Gram-positive bacteria. Target: Parasite, Antibiotic. Smiles: O=CN(CCCP([O-])(O)=O)O.[Na+]. References: Kojo H, et al. FR-31564, a new phosphonic acid...
| Schlagworte: | FR-31564 sodium salt |
| CAS | 66508-37-0 |
| MW: | 205.08 D |
66,00 €
