Zu "65733-16-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
S-Methoprene
Artikelnummer: TGM-T19752-100mg
Description: S-Methoprene (ZR2458) is an analog of juvenile hormone and can be used as an insecticide. S-Methoprene alters redox activity of cytochrome oxidase and induces male sex differentiation. Target: Others. Smiles: COC(C)(C)CCC[C@H](C)C\C=C\C(\C)=C\C(=O)OC(C)C. References: Dhopeshwarkar AS, Nicholson RA....
| Schlagworte: | (+)-Methoprene, ZR-2458, Preco, ZR 2458, ZR2458 |
| CAS | 65733-16-6 |
| MW: | 310.47 D |
ab 42,00 €
S(+)-Methoprene
Artikelnummer: LKT-M1978.100
An amber colored liquid is a juvenile hormone analog used as an insect growth regulator.
| Schlagworte: | Altosid, Apex, Diacan, Dianex, Kabat, Minex, Pharorid, Precor, ZR-515 |
| Anwendung: | Juvenile hormone analog |
| CAS | 65733-16-6 |
| MW: | 310.47 D |
ab 121,00 €
(S)-(+)-Methoprene
Artikelnummer: Cay16807-100
(S)-(+)-Methoprene is a widely used insect growth regulator. It is remarkable for its lack of significant effects against a wide variety of mammals, although concerns remain for its effects on arthropod development. Methoprene acts as an activator of the juvenile hormone receptor, known as Methoprene-tolerant or Met...
| Schlagworte: | Altosid(TM), d-Methoprene, ZR 2458, 11-methoxy-3,7S,11-trimethyl-2E,4E-dodecadienoic acid, 1-methylethyl ester |
| Anwendung: | TcMet activator, insect growth regulator |
| CAS | 65733-16-6 |
| MW: | 310.5 D |
ab 44,00 €
